2,6-Dichloro-4-fluorobenzoic acid, 98%
cas: 232275-55-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-fluorobenzoic acid, 98% (CAS 232275-55-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 25g, 10g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F220633-50MG |
| cas | 232275-55-7 |
| size | 50mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 279.09 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 742.46 Pln | |
| Fluorochem | 5g | 2325.24 Pln | |
| Fluorochem | 25g | 6808.04 Pln | |
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 2267.19 Pln | |
| Ambeed | 10g | 3774.62 Pln | |
| Ambeed | 25g | 6789.50 Pln | |
| Ambeed | 100g | 22036.31 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2,6-dichloro-4-fluorobenzoic acid (CAS 232275-55-7) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,6-dichloro-4-fluorobenzoic acid. InChIKey: NLVLBEXWAAXPCO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 2,6-dichloro-4-fluorobenzoic acid |
| InChIKey | NLVLBEXWAAXPCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Cl)F |
Computed by PubChem (NCBI)