cas: 15307-93-4 — see every product listed under this CAS number, including other names
2,6-Dichloro-N-phenylaniline, 98% (CAS 15307-93-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239225-25G |
| cas | 15307-93-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 133.30 Pln | |
| Fluorochem | 500g | 357.18 Pln | |
| Fluorochem | 1kg | 664.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dichloro-N-phenylaniline (CAS 15307-93-4) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 2,6-dichloro-N-phenylaniline. InChIKey: HDUUZPLYVVQTKN-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 2,6-dichloro-N-phenylaniline |
| InChIKey | HDUUZPLYVVQTKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)