cas: 15307-93-4 — see every product listed under this CAS number, including other names
2,6-Dichlorodiphenylamine 98% (CAS 15307-93-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241841-5g |
| cas | 15307-93-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 236.88 Pln | |
| Ambeed | 500g | 531.69 Pln | |
| Ambeed | 1000g | 676.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A241841 |
2,6-dichloro-N-phenylaniline (CAS 15307-93-4) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 2,6-dichloro-N-phenylaniline. InChIKey: HDUUZPLYVVQTKN-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 2,6-dichloro-N-phenylaniline |
| InChIKey | HDUUZPLYVVQTKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)