cas: 15307-93-4 — see every product listed under this CAS number, including other names
2,6-Dichlorodiphenylamine, >98.0%(GC) (CAS 15307-93-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3778-25G |
| cas | 15307-93-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 128.18 Pln | |
| TCI | 250g | 728.08 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,6-dichloro-N-phenylaniline (CAS 15307-93-4) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 2,6-dichloro-N-phenylaniline. InChIKey: HDUUZPLYVVQTKN-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 2,6-dichloro-N-phenylaniline |
| InChIKey | HDUUZPLYVVQTKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)