cas: 101488-73-7 — see every product listed under this CAS number, including other names
2,6-Dihydroxyanthracene, >95.0%(GC) (CAS 101488-73-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5151-200MG |
| cas | 101488-73-7 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 324.87 Pln | |
| TCI | 1g | 1003.45 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
Anthracene-2,6-diol (CAS 101488-73-7) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: anthracene-2,6-diol. InChIKey: JBBHFHMVEOHFRE-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | anthracene-2,6-diol |
| InChIKey | JBBHFHMVEOHFRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)O)O |
Computed by PubChem (NCBI)