cas: 101488-73-7 — see every product listed under this CAS number, including other names
Anthracene-2,6-diol, 97% (CAS 101488-73-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F605527-100MG |
| cas | 101488-73-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 2705.32 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Anthracene-2,6-diol (CAS 101488-73-7) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: anthracene-2,6-diol. InChIKey: JBBHFHMVEOHFRE-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | anthracene-2,6-diol |
| InChIKey | JBBHFHMVEOHFRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)O)O |
Computed by PubChem (NCBI)