2,7-Dibromoquinoline, 95%
cas: 1334405-59-2 — see every product listed under this CAS number, including other names
2,7-Dibromoquinoline, 95% (CAS 1334405-59-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F235258-250MG |
| cas | 1334405-59-2 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 336.36 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 1972.38 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1475.60 Pln | |
| Fluorochem | 5g | 2023.26 Pln | |
| Fluorochem | 1g | 711.23 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2124.83 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2,7-dibromoquinoline (CAS 1334405-59-2) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 2,7-dibromoquinoline. InChIKey: IDHADAAFHVDGIL-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 2,7-dibromoquinoline |
| InChIKey | IDHADAAFHVDGIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Br)Br |
Computed by PubChem (NCBI)