CAS 34522-69-5 appears in our catalog under these names: 5,7-Dibromoquinoline, 95%, 5,7–Dibromoquinoline, 5,7-Dibromoquinoline, 5,7-Dibromoquinoline 95%, 5,7-Dibromoquinoline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 5g, 25g, 50mg, 500mg.
5,7-dibromoquinoline (CAS 34522-69-5) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 5,7-dibromoquinoline. InChIKey: VYTOCZMQXCNIPD-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 5,7-dibromoquinoline |
| InChIKey | VYTOCZMQXCNIPD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2Br)Br)N=C1 |
Computed by PubChem (NCBI)