CAS 53987-60-3 appears in our catalog under these names: 1,3-Dibromoisoquinoline, 95%, 1,3-Dibromoisoquinoline 95%, 1,3-Dibromoisoquinoline, 95%, 95%, 1,3-Dibromoisoquinoline, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100g, 100mg.
1,3-dibromoisoquinoline (CAS 53987-60-3) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 1,3-dibromoisoquinoline. InChIKey: JXDSEHLVLUASEI-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 1,3-dibromoisoquinoline |
| InChIKey | JXDSEHLVLUASEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=C2Br)Br |
Computed by PubChem (NCBI)