CAS 81278-86-6 appears in our catalog under these names: 5,8–Dibromoquinoline, 5,8-Dibromoquinoline, 5,8-Dibromoquinoline 98%, 5,8-Dibromoquinoline, 98%, 98%, 5,8-Dibromoquinoline, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 100g.
5,8-dibromoquinoline (CAS 81278-86-6) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 5,8-dibromoquinoline. InChIKey: LCSHATKNSDVDRY-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 5,8-dibromoquinoline |
| InChIKey | LCSHATKNSDVDRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Br)Br |
Computed by PubChem (NCBI)