CAS 13721-00-1 appears in our catalog under these names: 2,3-Dibromoquinoline, 98%, 2,3–Dibromoquinoline, 2,3-Dibromoquinoline 98%, 2,3-Dibromoquinoline, 98%, 98%, 2,3-Dibromoquinoline, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,3-dibromoquinoline (CAS 13721-00-1) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 2,3-dibromoquinoline. InChIKey: KWVPZTJLHQKCKD-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 2,3-dibromoquinoline |
| InChIKey | KWVPZTJLHQKCKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)Br)Br |
Computed by PubChem (NCBI)