CAS 101861-59-0 appears in our catalog under these names: 3,5-Dibromoquinoline, 95%, 3,5-Dibromoquinoline, 96% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 5g, 1g.
3,5-dibromoquinoline (CAS 101861-59-0) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 3,5-dibromoquinoline. InChIKey: IBADFXOMCWHDMS-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 3,5-dibromoquinoline |
| InChIKey | IBADFXOMCWHDMS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Br)C(=C1)Br |
Computed by PubChem (NCBI)