CAS 700871-88-1 appears in our catalog under these names: 4,7-Dibromoquinoline, 97%, 4,7-Dibromoquinoline 97%, 4,7-Dibromoquinoline, 97%, 97%, 4,7-Dibromoquinoline, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
4,7-dibromoquinoline (CAS 700871-88-1) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 4,7-dibromoquinoline. InChIKey: FARNFRFWNKSWAN-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 4,7-dibromoquinoline |
| InChIKey | FARNFRFWNKSWAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Br)Br |
Computed by PubChem (NCBI)