Products 41320-96-1
CAS 41320-96-1 appears in our catalog under these names: 3,4-Dibromoquinoline, 95%, 3，4–Dibromoquinoline, 3,4-Dibromoquinoline 97%, 3,4-Dibromoquinoline, 97%, 97%, 3,4-Dibromoquinoline, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
3,4-dibromoquinoline (CAS 41320-96-1) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 3,4-dibromoquinoline. InChIKey: LLLPNGRKHYDSQJ-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 3,4-dibromoquinoline |
| InChIKey | LLLPNGRKHYDSQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C=N2)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
3,4-Dibromoquinoline, Quinoline, 3,4-dibromo-