CAS 51206-40-7 appears in our catalog under these names: 1,4–Dibromoisoquinoline, 1,4-Dibromoisoquinoline 95%, Isoquinoline, 1,4-dibromo-, 97%, 97%, 1,4-Dibromoisoquinoline, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 100mg.
1,4-dibromoisoquinoline (CAS 51206-40-7) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 1,4-dibromoisoquinoline. InChIKey: KXAHDPKQOFASEB-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 1,4-dibromoisoquinoline |
| InChIKey | KXAHDPKQOFASEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Br)Br |
Computed by PubChem (NCBI)