2,7-Dimethylpyrene, 95%
cas: 15679-24-0 — see every product listed under this CAS number, including other names
2,7-Dimethylpyrene, 95% (CAS 15679-24-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A874887-100mg |
| cas | 15679-24-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 887.69 Pln | |
| Ambeed | 250mg | 1393.88 Pln | |
| Ambeed | 1g | 3351.88 Pln | |
| Chemat | 100mg | 1173.20 Pln | |
| Chemat | 250mg | 1730.00 Pln | |
| Chemat | 1g | 4230.80 Pln | |
| BLDpharm | 100mg | 953.02 Pln | |
| BLDpharm | 250mg | 1497.28 Pln | |
| BLDpharm | 1g | 3607.64 Pln | |
| Fluorochem | 100mg | 2174.25 Pln | |
| Fluorochem | 250mg | 3225.97 Pln | |
| Fluorochem | 1g | 7703.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,7-dimethylpyrene (CAS 15679-24-0) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 2,7-dimethylpyrene. InChIKey: GSKHIRFMTJUBSM-UHFFFAOYSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 2,7-dimethylpyrene |
| InChIKey | GSKHIRFMTJUBSM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C3C(=C1)C=CC4=CC(=CC(=C43)C=C2)C |
Computed by PubChem (NCBI)