Products 1718-51-0
CAS 1718-51-0 appears in our catalog under these names: p-Terphenyl-d14, >95% (HPLC), p-Terphenyl D14, p-Terphenyl D14 1000 µg/mL in Acetone, p-Terphenyl D14 500 µg/mL in Dichloromethane, p-Terphenyl-d14, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 500mg, 10mg, 1ml, 0,5g, 50mg, 2g.
1,2,3,4,5-pentadeuterio-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene (CAS 1718-51-0) is a chemical compound with the molecular formula C18H14 and a molecular weight of 244.4 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene. InChIKey: XJKSTNDFUHDPQJ-WZAAGXFHSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 244.4 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene |
| InChIKey | XJKSTNDFUHDPQJ-WZAAGXFHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)