cas: 575-90-6 — see every product listed under this CAS number, including other names
2–(2,6–Dichlorophenoxy)acetic acid (CAS 575-90-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF42168-100mg |
| cas | 575-90-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 601.72 Pln | |
| GLPBio | 1g | 1205.50 Pln | |
| GLPBio | 250mg | 732.77 Pln | |
| GLPBio | 5g | 3190.04 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2,6-dichlorophenoxy)acetic acid (CAS 575-90-6) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)acetic acid. InChIKey: KHZWIIFEFQBNKL-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)acetic acid |
| InChIKey | KHZWIIFEFQBNKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC(=O)O)Cl |
Computed by PubChem (NCBI)