cas: 575-90-6 — see every product listed under this CAS number, including other names
2-(2,6-Dichlorophenoxy)acetic acid, 97% (CAS 575-90-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F540457-5G |
| cas | 575-90-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 5136.75 Pln | |
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,6-dichlorophenoxy)acetic acid (CAS 575-90-6) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)acetic acid. InChIKey: KHZWIIFEFQBNKL-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)acetic acid |
| InChIKey | KHZWIIFEFQBNKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC(=O)O)Cl |
Computed by PubChem (NCBI)