cas: 1020056-98-7 — see every product listed under this CAS number, including other names
2，3–Dibromoisonicotinic acid (CAS 1020056-98-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF39494-100mg |
| cas | 1020056-98-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 597.04 Pln | |
| GLPBio | 1g | 957.44 Pln | |
| GLPBio | 250mg | 718.73 Pln | |
| GLPBio | 5g | 2576.89 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-dibromopyridine-4-carboxylic acid (CAS 1020056-98-7) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,3-dibromopyridine-4-carboxylic acid. InChIKey: ICISUZSRQHUJKX-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,3-dibromopyridine-4-carboxylic acid |
| InChIKey | ICISUZSRQHUJKX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)