cas: 400779-65-9 — see every product listed under this CAS number, including other names
2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-2-methylpropanoic acid, 98% (CAS 400779-65-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F618818-250MG |
| cas | 400779-65-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1341.21 Pln | |
| Fluorochem | 10g | 2158.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid (CAS 400779-65-9) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid. InChIKey: HFPNKXXPYGPHJQ-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid |
| InChIKey | HFPNKXXPYGPHJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)