FMOC-N-ME-AIB-OH, 98%, 98%
cas: 400779-65-9 — see every product listed under this CAS number, including other names
FMOC-N-ME-AIB-OH, 98%, 98% (CAS 400779-65-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QNV-25g |
| cas | 400779-65-9 |
| size | 25g |
| availability | 40.8g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 2646.80 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1269.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid (CAS 400779-65-9) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid. InChIKey: HFPNKXXPYGPHJQ-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid |
| InChIKey | HFPNKXXPYGPHJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-N-Me-Aib-OH, N-Fmoc-alpha-(methylamino)isobutyric acid, N-Fmoc-N,2-dimethyl-DL-alanine, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-2-methylpropanoic acid, 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid, 2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-2-methylpropanoic acid, HFPNKXXPYGPHJQ-UHFFFAOYSA-N, Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N,2-dimethyl-, Fmoc-N-Me-Aib-OH, >=96.0%, 2-[Fmoc(methyl)amino]-2-methylpropanoic Acid