cas: 16344-26-6 — see every product listed under this CAS number, including other names
2-((4-Chlorophenyl)amino)nicotinic acid, 99%, 99% (CAS 16344-26-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112U5M-5mg |
| cas | 16344-26-6 |
| size | 5mg |
| availability | 0.075g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 318.80 Pln | |
| Chemat | 10mg | 443.60 Pln | |
| Chemat | 25mg | 635.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-(4-chloroanilino)pyridine-3-carboxylic acid (CAS 16344-26-6) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 2-(4-chloroanilino)pyridine-3-carboxylic acid. InChIKey: YEXIXVLEDGNAKM-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 2-(4-chloroanilino)pyridine-3-carboxylic acid |
| InChIKey | YEXIXVLEDGNAKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)