DHODH-IN-17 99%
cas: 16344-26-6 — see every product listed under this CAS number, including other names
DHODH-IN-17 99% (CAS 16344-26-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A501481-5mg |
| cas | 16344-26-6 |
| size | 5mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 375.94 Pln | |
| Ambeed | 10mg | 565.06 Pln | |
| Ambeed | 25mg | 1071.25 Pln | |
| Ambeed | 50mg | 1532.94 Pln | |
| Ambeed | 100mg | 2150.38 Pln | |
| Ambeed | 250mg | 3913.69 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A501481 |
2-(4-chloroanilino)pyridine-3-carboxylic acid (CAS 16344-26-6) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 2-(4-chloroanilino)pyridine-3-carboxylic acid. InChIKey: YEXIXVLEDGNAKM-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 2-(4-chloroanilino)pyridine-3-carboxylic acid |
| InChIKey | YEXIXVLEDGNAKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-Chloro-phenylamino)-nicotinic acid, 2-[(4-chlorophenyl)amino]pyridine-3-carboxylic acid, 2-((4-chlorophenyl)amino)pyridine-3-carboxylic acid, 2-[(4-Chlorophenyl)amino]nicotinic acid, 2-(4-chloroanilino)pyridine-3-carboxylic acid, 3-Pyridinecarboxylic acid, 2-[(4-chlorophenyl)amino]-, 2-((4-Chlorophenyl)amino)nicotinic acid, Oprea1_567832, 2-(4-chlorophenylamino)nicotinic acid, 2-(4-Chloro-phenylami