cas: 129-94-2 — see every product listed under this CAS number, including other names
2-((8-Chloronaphthalen-1-yl)thio)acetic acid, 95.0%, 95.0% (CAS 129-94-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YR4-5g |
| cas | 129-94-2 |
| size | 5g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 131.60 Pln |
| purity | 95.0% |
|---|---|
| delivery time | 3 weeks |
2-(8-chloronaphthalen-1-yl)sulfanylacetic acid (CAS 129-94-2) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 2-(8-chloronaphthalen-1-yl)sulfanylacetic acid. InChIKey: WPNAGQJVWAFQJV-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-(8-chloronaphthalen-1-yl)sulfanylacetic acid |
| InChIKey | WPNAGQJVWAFQJV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)SCC(=O)O)C(=CC=C2)Cl |
Computed by PubChem (NCBI)