CAS 129-94-2 appears in our catalog under these names: 2-(8-Chloro-1-naphthylthio)acetic acid, 95%, 2-((8-Chloro-1-naphthyl)thio)acetic acid, 2-((8-Chloronaphthalen-1-yl)thio)acetic acid, 98+%, (8–Chloro–1–naphthylthio)acetic Acid, (8-Chloro-1-naphthylthio)acetic Acid, >95.0%(T)(HPLC). Offered by: Combi-blocks, Biosynth, AmBeed, GLPBio, TCI. Available pack sizes: 1g, 5g, 10g, 25g.
2-(8-chloronaphthalen-1-yl)sulfanylacetic acid (CAS 129-94-2) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 2-(8-chloronaphthalen-1-yl)sulfanylacetic acid. InChIKey: WPNAGQJVWAFQJV-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-(8-chloronaphthalen-1-yl)sulfanylacetic acid |
| InChIKey | WPNAGQJVWAFQJV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)SCC(=O)O)C(=CC=C2)Cl |
Computed by PubChem (NCBI)