Products 1623-93-4
CAS 1623-93-4 appears in our catalog under these names: Biphenyl–4–sulfonyl chloride, 4-Biphenylsulfonyl chloride, 97%, 4-Biphenylsulfonyl chloride 95%, BIPHENYL-4-SULFONYL CHLORIDE, 4-Biphenylsulfonyl chloride, 99.59%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25mg, 5g, 25g, 1mg, 5mg, 10g, 50 g, 25 g.
4-phenylbenzenesulfonyl chloride (CAS 1623-93-4) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 4-phenylbenzenesulfonyl chloride. InChIKey: ALBQXDHCMLLQMB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 4-phenylbenzenesulfonyl chloride |
| InChIKey | ALBQXDHCMLLQMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Biphenyl]-4-sulfonyl chloride, (1,1'-Biphenyl)-4-sulphonyl chloride, (1,1'-Biphenyl)-4-sulfonyl chloride, [1,1'-biphenyl]-4-sulphonyl chloride, 4-Biphenylsulfonyl Chloride, Biphenyl-4-sulfonyl chloride, 4-Phenylbenzenesulfonyl chloride, C12H9ClO2S, 4-(Chlorosulfonyl)biphenyl, [1,1'-biphenyl]-4-sulfonylchloride