CAS 2688-90-6 appears in our catalog under these names: Biphenyl-2-sulfonyl chloride, 95%, (1,1'-Biphenyl)-2-sulfonyl chloride, 97%, Biphenyl–2–sulfonyl chloride, Biphenyl-2-sulfonyl chloride, [1,1'-Biphenyl]-2-sulfonyl chloride 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
2-phenylbenzenesulfonyl chloride (CAS 2688-90-6) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 2-phenylbenzenesulfonyl chloride. InChIKey: RENKNADFNRIRNZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-phenylbenzenesulfonyl chloride |
| InChIKey | RENKNADFNRIRNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)