CAS 65685-01-0 appears in our catalog under these names: 3-Phenylbenzenesulfonyl chloride, 95%, Biphenyl–3–sulfonyl chloride, [1,1'-Biphenyl]-3-sulfonyl chloride 95%, Biphenyl-3-sulfonyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-phenylbenzenesulfonyl chloride (CAS 65685-01-0) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 3-phenylbenzenesulfonyl chloride. InChIKey: LKSVJXWZVULUDA-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 3-phenylbenzenesulfonyl chloride |
| InChIKey | LKSVJXWZVULUDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)