Products 1099632-00-4

CAS 1099632-00-4 is the registry number for 5-(4-Chloro-2-methylphenyl)thiophene-2-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-(4-chloro-2-methylphenyl)thiophene-2-carboxylic acid (CAS 1099632-00-4) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 5-(4-chloro-2-methylphenyl)thiophene-2-carboxylic acid. InChIKey: NNZJHHRVOBRJED-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClO2S
Molecular weight252.72 g/mol
IUPAC name5-(4-chloro-2-methylphenyl)thiophene-2-carboxylic acid
InChIKeyNNZJHHRVOBRJED-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)Cl)C2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)