CAS 17070-55-2 appears in our catalog under these names: 1,2-dihydroacenaphthylene-5-sulfonyl chloride, 95%, 1,2-Dihydroacenaphthylene-5-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,2-dihydroacenaphthylene-5-sulfonyl chloride (CAS 17070-55-2) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 1,2-dihydroacenaphthylene-5-sulfonyl chloride. InChIKey: KBMKSUPJXFQYRA-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylene-5-sulfonyl chloride |
| InChIKey | KBMKSUPJXFQYRA-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=CC=CC1=C23)S(=O)(=O)Cl |
Computed by PubChem (NCBI)