Products 80-00-2
CAS 80-00-2 appears in our catalog under these names: 4-Chlorophenyl phenyl sulfone, 96%, Dapsone Impurity 1, 4-Chlorophenyl Phenyl Sulfone, >95% (HPLC), 4–Chlorophenyl Phenyl Sulfone, 4-Chlorophenyl Phenyl Sulfone, >96.0%(GC). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TCI. Available pack sizes: 1g, 25g, 5g, on request, 10g, 100g, 10 g, 5 g.
1-(benzenesulfonyl)-4-chlorobenzene (CAS 80-00-2) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-chlorobenzene. InChIKey: OFCFYWOKHPOXKF-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-chlorobenzene |
| InChIKey | OFCFYWOKHPOXKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)