Products 832740-61-1

CAS 832740-61-1 is the registry number for 5-(4-Chlorophenyl)-4-methylthiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-(4-chlorophenyl)-4-methylthiophene-2-carboxylic acid (CAS 832740-61-1) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 5-(4-chlorophenyl)-4-methylthiophene-2-carboxylic acid. InChIKey: QCPPOOWOUSJPRA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClO2S
Molecular weight252.72 g/mol
IUPAC name5-(4-chlorophenyl)-4-methylthiophene-2-carboxylic acid
InChIKeyQCPPOOWOUSJPRA-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1)C(=O)O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)