cas: 26378-66-5 — see every product listed under this CAS number, including other names
2-(2,4-Dichlorophenoxy)ethan-1-amine hydrochloride, 97% (CAS 26378-66-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A2255970-10g |
| cas | 26378-66-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16996.00 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 500mg | 1304.77 Pln | |
| Fluorochem | 1g | 1742.11 Pln | |
| Fluorochem | 2.5g | 3527.94 Pln | |
| Fluorochem | 5g | 5954.17 Pln | |
| Fluorochem | 10g | 7359.93 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2,4-dichlorophenoxy)ethanamine;hydrochloride (CAS 26378-66-5) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)ethanamine;hydrochloride. InChIKey: CLTFHMKADXXIQN-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)ethanamine;hydrochloride |
| InChIKey | CLTFHMKADXXIQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCCN.Cl |
Computed by PubChem (NCBI)