Products 2061980-13-8
CAS 2061980-13-8 appears in our catalog under these names: 2-Amino-2-(2,4-dichlorophenyl)ethan-1-ol hydrochloride, 95%, 2–Amino–2–(2，4–dichlorophenyl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
2-amino-2-(2,4-dichlorophenyl)ethanol;hydrochloride (CAS 2061980-13-8) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-amino-2-(2,4-dichlorophenyl)ethanol;hydrochloride. InChIKey: IGQRPXLLVWMSEH-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-amino-2-(2,4-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | IGQRPXLLVWMSEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CO)N.Cl |
Computed by PubChem (NCBI)