Products 1391564-88-7
CAS 1391564-88-7 appears in our catalog under these names: (2S)-2-Amino-2-(2,4-dichlorophenyl)ethan-1-ol hydrochloride, 95%, (S)–2–Amino–2–(2，4–dichlorophenyl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(2S)-2-amino-2-(2,4-dichlorophenyl)ethanol;hydrochloride (CAS 1391564-88-7) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: (2S)-2-amino-2-(2,4-dichlorophenyl)ethanol;hydrochloride. InChIKey: IGQRPXLLVWMSEH-DDWIOCJRSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | (2S)-2-amino-2-(2,4-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | IGQRPXLLVWMSEH-DDWIOCJRSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)