Products 2411638-49-6
CAS 2411638-49-6 appears in our catalog under these names: 2-Amino-2-(2,5-dichlorophenyl)ethan-1-ol hydrochloride, 95%, 2–Amino–2–(2，5–dichlorophenyl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-amino-2-(2,5-dichlorophenyl)ethanol;hydrochloride (CAS 2411638-49-6) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-amino-2-(2,5-dichlorophenyl)ethanol;hydrochloride. InChIKey: FYGNQNNTBLYRHC-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-amino-2-(2,5-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | FYGNQNNTBLYRHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(CO)N)Cl.Cl |
Computed by PubChem (NCBI)