CAS 85262-41-5 appears in our catalog under these names: 2-(3,5-Dichlorophenoxy)ethan-1-amine hydrochloride, 98%, 2-(3,5-Dichlorophenoxy)ethanamine hydrochloride, 98%, 98%, 2-(3,5-Dichlorophenoxy)ethanamine hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
2-(3,5-dichlorophenoxy)ethanamine;hydrochloride (CAS 85262-41-5) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-(3,5-dichlorophenoxy)ethanamine;hydrochloride. InChIKey: HMSLGXIQEKOVTB-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-(3,5-dichlorophenoxy)ethanamine;hydrochloride |
| InChIKey | HMSLGXIQEKOVTB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)OCCN.Cl |
Computed by PubChem (NCBI)