Products 2061980-48-9
CAS 2061980-48-9 appears in our catalog under these names: 2-Amino-2-(3,5-dichlorophenyl)ethan-1-ol hydrochloride, 95%, 2–Amino–2–(3，5–dichlorophenyl)ethanol hydrochloride, 2-Amino-2-(3,5-dichlorophenyl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-amino-2-(3,5-dichlorophenyl)ethanol;hydrochloride (CAS 2061980-48-9) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-amino-2-(3,5-dichlorophenyl)ethanol;hydrochloride. InChIKey: ODORLEGBXAZGAN-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-amino-2-(3,5-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | ODORLEGBXAZGAN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(CO)N.Cl |
Computed by PubChem (NCBI)