Products 38057-59-9
CAS 38057-59-9 is the registry number for Avanafil Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(3,5-dichloro-4-methoxyphenyl)methanamine;hydrochloride (CAS 38057-59-9) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: (3,5-dichloro-4-methoxyphenyl)methanamine;hydrochloride. InChIKey: DDSPYOWXFLINSI-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | (3,5-dichloro-4-methoxyphenyl)methanamine;hydrochloride |
| InChIKey | DDSPYOWXFLINSI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)CN)Cl.Cl |
Computed by PubChem (NCBI)