Products 1391568-88-9
CAS 1391568-88-9 appears in our catalog under these names: (S)-2-Amino-2-(2,6-dichlorophenyl)ethanol hydrochloride, 97%, (S)-2-Amino-2-(2,6-dichlorophenyl)ethanol hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
(2S)-2-amino-2-(2,6-dichlorophenyl)ethanol;hydrochloride (CAS 1391568-88-9) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: (2S)-2-amino-2-(2,6-dichlorophenyl)ethanol;hydrochloride. InChIKey: BHBIHHQAOJSNFC-OGFXRTJISA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | (2S)-2-amino-2-(2,6-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | BHBIHHQAOJSNFC-OGFXRTJISA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[C@@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)