Products 39089-57-1
CAS 39089-57-1 is the registry number for N,N-Diallyl-2,2,2-trichloroacetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trichloro-N,N-bis(prop-2-enyl)acetamide (CAS 39089-57-1) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2,2,2-trichloro-N,N-bis(prop-2-enyl)acetamide. InChIKey: FCLMEOAIBNBGBX-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2,2,2-trichloro-N,N-bis(prop-2-enyl)acetamide |
| InChIKey | FCLMEOAIBNBGBX-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)