cas: 214360-64-2 — see every product listed under this CAS number, including other names
2-(2,4-Dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 214360-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13213B-250mg |
| cas | 214360-64-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 10g | 659.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,4-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 214360-64-2) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RCCYMBKXLWUXTG-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RCCYMBKXLWUXTG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)C |
Computed by PubChem (NCBI)