2-(2-Chlorobenzyl)malonic acid, 95%
cas: 683215-17-0 — see every product listed under this CAS number, including other names
2-(2-Chlorobenzyl)malonic acid, 95% (CAS 683215-17-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1037780-100mg |
| cas | 683215-17-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1900.06 Pln | |
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 1926.80 Pln | |
| BLDpharm | 100mg | 464.31 Pln | |
| BLDpharm | 250mg | 736.43 Pln | |
| BLDpharm | 1g | 1869.37 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-[(2-chlorophenyl)methyl]propanedioic acid (CAS 683215-17-0) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: 2-[(2-chlorophenyl)methyl]propanedioic acid. InChIKey: KSQGBHMXXFRHQI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methyl]propanedioic acid |
| InChIKey | KSQGBHMXXFRHQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)