Products 2353774-41-9

CAS 2353774-41-9 is the registry number for 3-(2-Chloro-4-methoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2-chloro-4-methoxyphenyl)-2-oxopropanoic acid (CAS 2353774-41-9) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: 3-(2-chloro-4-methoxyphenyl)-2-oxopropanoic acid. InChIKey: FQKXSEQBBAVZPA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClO4
Molecular weight228.63 g/mol
IUPAC name3-(2-chloro-4-methoxyphenyl)-2-oxopropanoic acid
InChIKeyFQKXSEQBBAVZPA-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)CC(=O)C(=O)O)Cl

Computed by PubChem (NCBI)