Products 1487039-48-4

CAS 1487039-48-4 is the registry number for Ethyl 7-chlorobenzo[d][1,3]dioxole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 7-chloro-1,3-benzodioxole-5-carboxylate (CAS 1487039-48-4) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: ethyl 7-chloro-1,3-benzodioxole-5-carboxylate. InChIKey: JODDASPEOSHSLT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClO4
Molecular weight228.63 g/mol
IUPAC nameethyl 7-chloro-1,3-benzodioxole-5-carboxylate
InChIKeyJODDASPEOSHSLT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C(=C1)Cl)OCO2

Computed by PubChem (NCBI)