CAS 1487039-48-4 is the registry number for Ethyl 7-chlorobenzo[d][1,3]dioxole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-chloro-1,3-benzodioxole-5-carboxylate (CAS 1487039-48-4) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: ethyl 7-chloro-1,3-benzodioxole-5-carboxylate. InChIKey: JODDASPEOSHSLT-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | ethyl 7-chloro-1,3-benzodioxole-5-carboxylate |
| InChIKey | JODDASPEOSHSLT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C(=C1)Cl)OCO2 |
Computed by PubChem (NCBI)