Products 153750-10-8
CAS 153750-10-8 is the registry number for 2-Acetoxy-2-(4-chlorophenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-acetyloxy-2-(4-chlorophenyl)acetic acid (CAS 153750-10-8) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: 2-acetyloxy-2-(4-chlorophenyl)acetic acid. InChIKey: MIZLPLOCVAAQMG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-acetyloxy-2-(4-chlorophenyl)acetic acid |
| InChIKey | MIZLPLOCVAAQMG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)