Products 18643-84-0
CAS 18643-84-0 appears in our catalog under these names: Dimethyl chloroterephthalate, 95%, Dimethyl 2-chloroterephthalate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 25g.
Dimethyl 2-chlorobenzene-1,4-dicarboxylate (CAS 18643-84-0) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: dimethyl 2-chlorobenzene-1,4-dicarboxylate. InChIKey: FUFFCPIFRICMFH-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | dimethyl 2-chlorobenzene-1,4-dicarboxylate |
| InChIKey | FUFFCPIFRICMFH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)