Products 1099702-07-4
CAS 1099702-07-4 is the registry number for Methyl 8-chloro-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (CAS 1099702-07-4) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: methyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate. InChIKey: YZBOROQVLAJTDW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | methyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| InChIKey | YZBOROQVLAJTDW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Cl)OCCO2 |
Computed by PubChem (NCBI)