Products 58138-38-8
CAS 58138-38-8 appears in our catalog under these names: 1,2-Benzenedicarboxylic acid,4-chloro-,1,2-dimethyl ester, 95%, Dimethyl 4-chlorophthalate 95+%, Dimethyl 4-chlorophthalate, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
Dimethyl 4-chlorobenzene-1,2-dicarboxylate (CAS 58138-38-8) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: dimethyl 4-chlorobenzene-1,2-dicarboxylate. InChIKey: XPBFMFXGZOLOKX-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | dimethyl 4-chlorobenzene-1,2-dicarboxylate |
| InChIKey | XPBFMFXGZOLOKX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)